C25H26F3NO2S — CID 141407627
methyl 2-[2-methyl-4-(2,3,4-trifluoro-6-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl]pentanoate (PubChem CID 141407627) has the molecular formula C25H26F3NO2S and a molecular weight of 461.55 g/mol. Its IUPAC name is methyl 2-[2-methyl-4-(2,3,4-trifluoro-6-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl]pentanoate.
| Compound Name | methyl 2-[2-methyl-4-(2,3,4-trifluoro-6-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl]pentanoate |
|---|---|
| PubChem CID | 141407627 |
| Molecular Formula | C25H26F3NO2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 2-[2-methyl-4-(2,3,4-trifluoro-6-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl]pentanoate |
| SMILES | CCCC(C(=O)OC)c1c(C)nc2sc3c(c2c1-c1c(C)cc(F)c(F)c1F)CCCC3 |
| InChI | InChI=1S/C25H26F3NO2S/c1-5-8-15(25(30)31-4)19-13(3)29-24-20(14-9-6-7-10-17(14)32-24)21(19)18-12(2)11-16(26)22(27)23(18)28/h11,15H,5-10H2,1-4H3 |
| InChIKey | NXUBUDAYTQRAOY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|