C23H26N2O2S — CID 66597277
2-[11-methyl-13-(4-methylphenyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoic acid (PubChem CID 66597277) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[11-methyl-13-(4-methylphenyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoic acid.
| Compound Name | 2-[11-methyl-13-(4-methylphenyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoic acid |
|---|---|
| PubChem CID | 66597277 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-[11-methyl-13-(4-methylphenyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1)CNCC3 |
| InChI | InChI=1S/C23H26N2O2S/c1-4-5-16(23(26)27)19-14(3)25-22-21(17-12-24-11-10-18(17)28-22)20(19)15-8-6-13(2)7-9-15/h6-9,16,24H,4-5,10-12H2,1-3H3,(H,26,27) |
| InChIKey | GCSLEDFZNWMUIO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |