C16H35NO3Si — CID 141408613
N,N-ditert-butyl-2-methyl-4-trimethoxysilylbut-3-en-2-amine (PubChem CID 141408613) has the molecular formula C16H35NO3Si and a molecular weight of 317.55 g/mol. Its IUPAC name is N,N-ditert-butyl-2-methyl-4-trimethoxysilylbut-3-en-2-amine.
| Compound Name | N,N-ditert-butyl-2-methyl-4-trimethoxysilylbut-3-en-2-amine |
|---|---|
| PubChem CID | 141408613 |
| Molecular Formula | C16H35NO3Si |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N,N-ditert-butyl-2-methyl-4-trimethoxysilylbut-3-en-2-amine |
| SMILES | CO[Si](C=CC(C)(C)N(C(C)(C)C)C(C)(C)C)(OC)OC |
| InChI | InChI=1S/C16H35NO3Si/c1-14(2,3)17(15(4,5)6)16(7,8)12-13-21(18-9,19-10)20-11/h12-13H,1-11H3 |
| InChIKey | NSARPPXRSUPMHE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|