C26H57N3 — CID 174059884
1-N,1-N,1-N',1-N',1-N",1-N"-hexatert-butylethane-1,1,1-triamine (PubChem CID 174059884) has the molecular formula C26H57N3 and a molecular weight of 411.76 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',1-N",1-N"-hexatert-butylethane-1,1,1-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexatert-butylethane-1,1,1-triamine |
|---|---|
| PubChem CID | 174059884 |
| Molecular Formula | C26H57N3 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 411.46 |
| IUPAC Name | 1-N,1-N,1-N',1-N',1-N",1-N"-hexatert-butylethane-1,1,1-triamine |
| SMILES | CC(C)(C)N(C(C)(C)C)C(C)(N(C(C)(C)C)C(C)(C)C)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H57N3/c1-20(2,3)27(21(4,5)6)26(19,28(22(7,8)9)23(10,11)12)29(24(13,14)15)25(16,17)18/h1-19H3 |
| InChIKey | MLFAVFGZKLLTIY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|