About ethenoxyethene;ethenyl(trimethoxy)silane
ethenoxyethene;ethenyl(trimethoxy)silane (PubChem CID 174894710) has the molecular formula C9H18O4Si
and a molecular weight of 218.32 g/mol. Its IUPAC name is ethenoxyethene;ethenyl(trimethoxy)silane.
Molecular Properties
| Compound Name | ethenoxyethene;ethenyl(trimethoxy)silane |
| PubChem CID | 174894710 |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | ethenoxyethene;ethenyl(trimethoxy)silane |
| SMILES | C=COC=C.C=C[Si](OC)(OC)OC |
| InChI | InChI=1S/C5H12O3Si.C4H6O/c1-5-9(6-2,7-3)8-4;1-3-5-4-2/h5H,1H2,2-4H3;3-4H,1-2H2 |
| InChIKey | VHJMAZZGZSELFB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;ethenyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;ethenyl(trimethoxy)silane?
The IUPAC name of ethenoxyethene;ethenyl(trimethoxy)silane (CID 174894710) is ethenoxyethene;ethenyl(trimethoxy)silane.
What is the SMILES notation for ethenoxyethene;ethenyl(trimethoxy)silane?
The canonical SMILES for ethenoxyethene;ethenyl(trimethoxy)silane is C=COC=C.C=C[Si](OC)(OC)OC.
What is the InChIKey of ethenoxyethene;ethenyl(trimethoxy)silane?
The InChIKey is VHJMAZZGZSELFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3Si.C4H6O/c1-5-9(6-2,7-3)8-4;1-3-5-4-2/h5H,1H2,2-4H3;3-4H,1-2H2.
What are the key properties of ethenoxyethene;ethenyl(trimethoxy)silane?
ethenoxyethene;ethenyl(trimethoxy)silane has a molecular weight of 218.32 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;ethenyl(trimethoxy)silane is sourced from PubChem (CID 174894710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).