C11H24O6Si3 — CID 58309273
ethenyl-[ethenyl(dimethoxy)silyl]-[ethenyl(dimethoxy)silyl]oxy-methoxysilane (PubChem CID 58309273) has the molecular formula C11H24O6Si3 and a molecular weight of 336.57 g/mol. Its IUPAC name is ethenyl-[ethenyl(dimethoxy)silyl]-[ethenyl(dimethoxy)silyl]oxy-methoxysilane.
| Compound Name | ethenyl-[ethenyl(dimethoxy)silyl]-[ethenyl(dimethoxy)silyl]oxy-methoxysilane |
|---|---|
| PubChem CID | 58309273 |
| Molecular Formula | C11H24O6Si3 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethenyl-[ethenyl(dimethoxy)silyl]-[ethenyl(dimethoxy)silyl]oxy-methoxysilane |
| SMILES | C=C[Si](OC)(OC)O[Si](C=C)(OC)[Si](C=C)(OC)OC |
| InChI | InChI=1S/C11H24O6Si3/c1-9-18(12-4,13-5)17-20(11-3,16-8)19(10-2,14-6)15-7/h9-11H,1-3H2,4-8H3 |
| InChIKey | YVSPZANSCWDJHW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|