C10H24O6Si2 — CID 163824474
ethenyl(trimethoxy)silane;1,2,2-trimethoxyethenylsilane (PubChem CID 163824474) has the molecular formula C10H24O6Si2 and a molecular weight of 296.47 g/mol. Its IUPAC name is ethenyl(trimethoxy)silane;1,2,2-trimethoxyethenylsilane.
| Compound Name | ethenyl(trimethoxy)silane;1,2,2-trimethoxyethenylsilane |
|---|---|
| PubChem CID | 163824474 |
| Molecular Formula | C10H24O6Si2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | ethenyl(trimethoxy)silane;1,2,2-trimethoxyethenylsilane |
| SMILES | C=C[Si](OC)(OC)OC.COC([SiH3])=C(OC)OC |
| InChI | InChI=1S/2C5H12O3Si/c1-6-4(7-2)5(9)8-3;1-5-9(6-2,7-3)8-4/h1-3,9H3;5H,1H2,2-4H3 |
| InChIKey | NYGCDZPMNMMAOJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|