C5H12CuO3Si+ — CID 162211744
copper(1+);1,2,2-trimethoxyethenylsilane (PubChem CID 162211744) has the molecular formula C5H12CuO3Si+ and a molecular weight of 211.78 g/mol. Its IUPAC name is copper(1+);1,2,2-trimethoxyethenylsilane.
| Compound Name | copper(1+);1,2,2-trimethoxyethenylsilane |
|---|---|
| PubChem CID | 162211744 |
| Molecular Formula | C5H12CuO3Si+ |
| Molecular Weight | 211.78 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | copper(1+);1,2,2-trimethoxyethenylsilane |
| SMILES | COC([SiH3])=C(OC)OC.[Cu+] |
| InChI | InChI=1S/C5H12O3Si.Cu/c1-6-4(7-2)5(9)8-3;/h1-3,9H3;/q;+1 |
| InChIKey | ZSXVZEGKVLPDRQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.78 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|