About copper(1+);1,2,2-trimethoxyethenylsilane
copper(1+);1,2,2-trimethoxyethenylsilane (PubChem CID 162211744) has the molecular formula C5H12CuO3Si+
and a molecular weight of 211.78 g/mol. Its IUPAC name is copper(1+);1,2,2-trimethoxyethenylsilane.
Molecular Properties
| Compound Name | copper(1+);1,2,2-trimethoxyethenylsilane |
| PubChem CID | 162211744 |
| Molecular Formula | C5H12CuO3Si+ |
| Molecular Weight | 211.78 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | copper(1+);1,2,2-trimethoxyethenylsilane |
| SMILES | COC([SiH3])=C(OC)OC.[Cu+] |
| InChI | InChI=1S/C5H12O3Si.Cu/c1-6-4(7-2)5(9)8-3;/h1-3,9H3;/q;+1 |
| InChIKey | ZSXVZEGKVLPDRQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.78 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1,2,2-trimethoxyethenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1,2,2-trimethoxyethenylsilane?
The IUPAC name of copper(1+);1,2,2-trimethoxyethenylsilane (CID 162211744) is copper(1+);1,2,2-trimethoxyethenylsilane.
What is the SMILES notation for copper(1+);1,2,2-trimethoxyethenylsilane?
The canonical SMILES for copper(1+);1,2,2-trimethoxyethenylsilane is COC([SiH3])=C(OC)OC.[Cu+].
What is the InChIKey of copper(1+);1,2,2-trimethoxyethenylsilane?
The InChIKey is ZSXVZEGKVLPDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3Si.Cu/c1-6-4(7-2)5(9)8-3;/h1-3,9H3;/q;+1.
What are the key properties of copper(1+);1,2,2-trimethoxyethenylsilane?
copper(1+);1,2,2-trimethoxyethenylsilane has a molecular weight of 211.78 g/mol, XLogP of -0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1,2,2-trimethoxyethenylsilane is sourced from PubChem (CID 162211744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).