About [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane
[diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane (PubChem CID 87821669) has the molecular formula C13H24O9Si2
and a molecular weight of 380.50 g/mol. Its IUPAC name is [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane.
Molecular Properties
| Compound Name | [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane |
| PubChem CID | 87821669 |
| Molecular Formula | C13H24O9Si2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane |
| SMILES | C=C[Si](OC(C)=O)(OC(C)=O)OC(C)=O.C=C[Si](OC)(OC)OC |
| InChI | InChI=1S/C8H12O6Si.C5H12O3Si/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11;1-5-9(6-2,7-3)8-4/h5H,1H2,2-4H3;5H,1H2,2-4H3 |
| InChIKey | KGQMPMJGGQREHU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane?
The IUPAC name of [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane (CID 87821669) is [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane.
What is the SMILES notation for [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane?
The canonical SMILES for [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane is C=C[Si](OC(C)=O)(OC(C)=O)OC(C)=O.C=C[Si](OC)(OC)OC.
What is the InChIKey of [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane?
The InChIKey is KGQMPMJGGQREHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O6Si.C5H12O3Si/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11;1-5-9(6-2,7-3)8-4/h5H,1H2,2-4H3;5H,1H2,2-4H3.
What are the key properties of [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane?
[diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane has a molecular weight of 380.50 g/mol, XLogP of 0.93, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(ethenyl)silyl] acetate;ethenyl(trimethoxy)silane is sourced from PubChem (CID 87821669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).