About ethenyl(trimethoxy)silane;ethoxy(ethyl)silane
ethenyl(trimethoxy)silane;ethoxy(ethyl)silane (PubChem CID 174653846) has the molecular formula C9H24O4Si2
and a molecular weight of 252.46 g/mol. Its IUPAC name is ethenyl(trimethoxy)silane;ethoxy(ethyl)silane.
Molecular Properties
| Compound Name | ethenyl(trimethoxy)silane;ethoxy(ethyl)silane |
| PubChem CID | 174653846 |
| Molecular Formula | C9H24O4Si2 |
| Molecular Weight | 252.46 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | ethenyl(trimethoxy)silane;ethoxy(ethyl)silane |
| SMILES | C=C[Si](OC)(OC)OC.CCO[SiH2]CC |
| InChI | InChI=1S/C5H12O3Si.C4H12OSi/c1-5-9(6-2,7-3)8-4;1-3-5-6-4-2/h5H,1H2,2-4H3;3-4,6H2,1-2H3 |
| InChIKey | KIXXWQKMOYGZRC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(trimethoxy)silane;ethoxy(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(trimethoxy)silane;ethoxy(ethyl)silane?
The IUPAC name of ethenyl(trimethoxy)silane;ethoxy(ethyl)silane (CID 174653846) is ethenyl(trimethoxy)silane;ethoxy(ethyl)silane.
What is the SMILES notation for ethenyl(trimethoxy)silane;ethoxy(ethyl)silane?
The canonical SMILES for ethenyl(trimethoxy)silane;ethoxy(ethyl)silane is C=C[Si](OC)(OC)OC.CCO[SiH2]CC.
What is the InChIKey of ethenyl(trimethoxy)silane;ethoxy(ethyl)silane?
The InChIKey is KIXXWQKMOYGZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3Si.C4H12OSi/c1-5-9(6-2,7-3)8-4;1-3-5-6-4-2/h5H,1H2,2-4H3;3-4,6H2,1-2H3.
What are the key properties of ethenyl(trimethoxy)silane;ethoxy(ethyl)silane?
ethenyl(trimethoxy)silane;ethoxy(ethyl)silane has a molecular weight of 252.46 g/mol, XLogP of 1.13, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(trimethoxy)silane;ethoxy(ethyl)silane is sourced from PubChem (CID 174653846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).