C10H24O5Si2 — CID 173096519
1,1-dimethoxyprop-2-enylsilane;ethenyl(trimethoxy)silane (PubChem CID 173096519) has the molecular formula C10H24O5Si2 and a molecular weight of 280.47 g/mol. Its IUPAC name is 1,1-dimethoxyprop-2-enylsilane;ethenyl(trimethoxy)silane.
| Compound Name | 1,1-dimethoxyprop-2-enylsilane;ethenyl(trimethoxy)silane |
|---|---|
| PubChem CID | 173096519 |
| Molecular Formula | C10H24O5Si2 |
| Molecular Weight | 280.47 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1,1-dimethoxyprop-2-enylsilane;ethenyl(trimethoxy)silane |
| SMILES | C=CC([SiH3])(OC)OC.C=C[Si](OC)(OC)OC |
| InChI | InChI=1S/C5H12O3Si.C5H12O2Si/c1-5-9(6-2,7-3)8-4;1-4-5(8,6-2)7-3/h5H,1H2,2-4H3;4H,1H2,2-3,8H3 |
| InChIKey | WXOAEQCHEZNBKA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|