C11H19NS — CID 141410211
1-isothiocyanato-1,3,3,5-tetramethylcyclohexane (PubChem CID 141410211) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 1-isothiocyanato-1,3,3,5-tetramethylcyclohexane.
| Compound Name | 1-isothiocyanato-1,3,3,5-tetramethylcyclohexane |
|---|---|
| PubChem CID | 141410211 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-isothiocyanato-1,3,3,5-tetramethylcyclohexane |
| SMILES | CC1CC(C)(C)CC(C)(N=C=S)C1 |
| InChI | InChI=1S/C11H19NS/c1-9-5-10(2,3)7-11(4,6-9)12-8-13/h9H,5-7H2,1-4H3 |
| InChIKey | PEXJQABCZQDCAR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|