C13H19NS — CID 98044283
(3S,5S)-1-isothiocyanato-3,5-dimethyladamantane (PubChem CID 98044283) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is (3S,5S)-1-isothiocyanato-3,5-dimethyladamantane.
| Compound Name | (3S,5S)-1-isothiocyanato-3,5-dimethyladamantane |
|---|---|
| PubChem CID | 98044283 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3S,5S)-1-isothiocyanato-3,5-dimethyladamantane |
| SMILES | C[C@@]12CC3CC(N=C=S)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C13H19NS/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)14-9-15/h10H,3-8H2,1-2H3/t10?,11-,12-,13?/m0/s1 |
| InChIKey | GXBQJLFQKPPSHC-ZFQMDJOTSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|