C21H39NO6 — CID 141410246
N-methyl-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]tetradec-9-enamide (PubChem CID 141410246) has the molecular formula C21H39NO6 and a molecular weight of 401.54 g/mol. Its IUPAC name is N-methyl-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]tetradec-9-enamide.
| Compound Name | N-methyl-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]tetradec-9-enamide |
|---|---|
| PubChem CID | 141410246 |
| Molecular Formula | C21H39NO6 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | N-methyl-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]tetradec-9-enamide |
| SMILES | CCCCC=CCCCCCCCC(=O)N(C)[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H39NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(24)22(2)18-20(26)19(25)16(15-23)28-21(18)27/h6-7,16,18-21,23,25-27H,3-5,8-15H2,1-2H3/t16-,18-,19-,20-,21?/m1/s1 |
| InChIKey | SWGAGQAXLWDNEI-LIDDZCSYSA-N |
| XLogP | 1.72 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|