1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid

C7H4ClN3O2 — CID 141410941

IUPAC1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid
SMILESO=C(O)c1cnc2c(cnn2Cl)c1
InChIInChI=1S/C7H4ClN3O2/c8-11-6-4(3-10-11)1-5(2-9-6)7(12)13/h1-3H,(H,12,13)
InChIKeyPLWYUFGEQCMGDG-UHFFFAOYSA-N
MW197.58 g/mol
LogP1.13
Rot. Bonds1

About 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid

1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid (PubChem CID 141410941) has the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. Its IUPAC name is 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid.

Molecular Properties

Compound Name1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid
PubChem CID141410941
Molecular FormulaC7H4ClN3O2
Molecular Weight197.58 g/mol
Exact Mass197.00
IUPAC Name1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid
SMILESO=C(O)c1cnc2c(cnn2Cl)c1
InChIInChI=1S/C7H4ClN3O2/c8-11-6-4(3-10-11)1-5(2-9-6)7(12)13/h1-3H,(H,12,13)
InChIKeyPLWYUFGEQCMGDG-UHFFFAOYSA-N
XLogP1.13
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.58
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid?
The IUPAC name of 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid (CID 141410941) is 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid.
What is the SMILES notation for 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid?
The canonical SMILES for 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid is O=C(O)c1cnc2c(cnn2Cl)c1.
What is the InChIKey of 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid?
The InChIKey is PLWYUFGEQCMGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O2/c8-11-6-4(3-10-11)1-5(2-9-6)7(12)13/h1-3H,(H,12,13).
What are the key properties of 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid?
1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid has a molecular weight of 197.58 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropyrazolo[3,4-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 141410941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).