C10H10N2O3 — CID 117275923
1-(2-hydroxyethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid (PubChem CID 117275923) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 117275923 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 1-(2-hydroxyethyl)pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(ccn2CCO)c1 |
| InChI | InChI=1S/C10H10N2O3/c13-4-3-12-2-1-7-5-8(10(14)15)6-11-9(7)12/h1-2,5-6,13H,3-4H2,(H,14,15) |
| InChIKey | FBMRJQCHLBGERE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |