C14H17F2NO — CID 141413234
9,9-difluoro-10-methyl-1,2,3,4,5,8-hexahydrocyclopenta[i][3]benzazepin-10-ol (PubChem CID 141413234) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 9,9-difluoro-10-methyl-1,2,3,4,5,8-hexahydrocyclopenta[i][3]benzazepin-10-ol.
| Compound Name | 9,9-difluoro-10-methyl-1,2,3,4,5,8-hexahydrocyclopenta[i][3]benzazepin-10-ol |
|---|---|
| PubChem CID | 141413234 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 9,9-difluoro-10-methyl-1,2,3,4,5,8-hexahydrocyclopenta[i][3]benzazepin-10-ol |
| SMILES | CC1(O)c2c(ccc3c2CCNCC3)CC1(F)F |
| InChI | InChI=1S/C14H17F2NO/c1-13(18)12-10(8-14(13,15)16)3-2-9-4-6-17-7-5-11(9)12/h2-3,17-18H,4-8H2,1H3 |
| InChIKey | ISIZYEYCGPSXGL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |