C13H18N2O — CID 163862535
3-(7-amino-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)prop-1-en-2-ol (PubChem CID 163862535) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(7-amino-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)prop-1-en-2-ol.
| Compound Name | 3-(7-amino-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)prop-1-en-2-ol |
|---|---|
| PubChem CID | 163862535 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-(7-amino-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)prop-1-en-2-ol |
| SMILES | C=C(O)Cc1c(N)ccc2c1CCNCC2 |
| InChI | InChI=1S/C13H18N2O/c1-9(16)8-12-11-5-7-15-6-4-10(11)2-3-13(12)14/h2-3,15-16H,1,4-8,14H2 |
| InChIKey | PDUVKDLJKBGTCJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|