C9H12N2O — CID 84651923
6-amino-1,2,3,4-tetrahydroisoquinolin-5-ol (PubChem CID 84651923) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-amino-1,2,3,4-tetrahydroisoquinolin-5-ol.
| Compound Name | 6-amino-1,2,3,4-tetrahydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 84651923 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 6-amino-1,2,3,4-tetrahydroisoquinolin-5-ol |
| SMILES | Nc1ccc2c(c1O)CCNC2 |
| InChI | InChI=1S/C9H12N2O/c10-8-2-1-6-5-11-4-3-7(6)9(8)12/h1-2,11-12H,3-5,10H2 |
| InChIKey | FLRIAWXYLDFQAC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|