C6H13N3O2 — CID 141413299
2-nitrocyclohexane-1,1-diamine (PubChem CID 141413299) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-nitrocyclohexane-1,1-diamine.
| Compound Name | 2-nitrocyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 141413299 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-nitrocyclohexane-1,1-diamine |
| SMILES | NC1(N)CCCCC1[N+](=O)[O-] |
| InChI | InChI=1S/C6H13N3O2/c7-6(8)4-2-1-3-5(6)9(10)11/h5H,1-4,7-8H2 |
| InChIKey | VYMACFACDWYXRG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|