C9H8BrNO3 — CID 141413930
5-bromo-7-methoxy-3a,4-dihydro-1H-indole-2,3-dione (PubChem CID 141413930) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is 5-bromo-7-methoxy-3a,4-dihydro-1H-indole-2,3-dione.
| Compound Name | 5-bromo-7-methoxy-3a,4-dihydro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 141413930 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 5-bromo-7-methoxy-3a,4-dihydro-1H-indole-2,3-dione |
| SMILES | COC1=C2NC(=O)C(=O)C2CC(Br)=C1 |
| InChI | InChI=1S/C9H8BrNO3/c1-14-6-3-4(10)2-5-7(6)11-9(13)8(5)12/h3,5H,2H2,1H3,(H,11,13) |
| InChIKey | SIDNNYFVZFIFOQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|