C9H8BrNO2 — CID 141394927
6-bromo-7-methyl-3a,4-dihydro-1H-indole-2,3-dione (PubChem CID 141394927) has the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. Its IUPAC name is 6-bromo-7-methyl-3a,4-dihydro-1H-indole-2,3-dione.
| Compound Name | 6-bromo-7-methyl-3a,4-dihydro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 141394927 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 6-bromo-7-methyl-3a,4-dihydro-1H-indole-2,3-dione |
| SMILES | CC1=C2NC(=O)C(=O)C2CC=C1Br |
| InChI | InChI=1S/C9H8BrNO2/c1-4-6(10)3-2-5-7(4)11-9(13)8(5)12/h3,5H,2H2,1H3,(H,11,13) |
| InChIKey | STJCMZNFTHHGQH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|