C8H7FN2O2 — CID 141228715
7-fluoro-3-hydroxyimino-3a,4-dihydro-1H-indol-2-one (PubChem CID 141228715) has the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. Its IUPAC name is 7-fluoro-3-hydroxyimino-3a,4-dihydro-1H-indol-2-one.
| Compound Name | 7-fluoro-3-hydroxyimino-3a,4-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 141228715 |
| Molecular Formula | C8H7FN2O2 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 7-fluoro-3-hydroxyimino-3a,4-dihydro-1H-indol-2-one |
| SMILES | O=C1NC2=C(F)C=CCC2C1=NO |
| InChI | InChI=1S/C8H7FN2O2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11-13/h1,3-4,13H,2H2,(H,10,12) |
| InChIKey | HEDUWDPABDFLHI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|