C4H7FN4O3 — CID 136828471
(4S,5R)-5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one (PubChem CID 136828471) has the molecular formula C4H7FN4O3 and a molecular weight of 178.12 g/mol. Its IUPAC name is (4S,5R)-5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one.
| Compound Name | (4S,5R)-5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 136828471 |
| Molecular Formula | C4H7FN4O3 |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (4S,5R)-5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one |
| SMILES | O=C1NC(=NO)[C@H](F)[C@H](NO)N1 |
| InChI | InChI=1S/C4H7FN4O3/c5-1-2(8-11)6-4(10)7-3(1)9-12/h1-2,8,11-12H,(H2,6,7,9,10)/t1-,2+/m1/s1 |
| InChIKey | LWWXCISNIBMHOL-NCGGTJAESA-N |
| XLogP | -1.27 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|