About 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one
5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one (PubChem CID 135428254) has the molecular formula C4H7FN4O3
and a molecular weight of 178.12 g/mol. Its IUPAC name is 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one |
| PubChem CID | 135428254 |
| Molecular Formula | C4H7FN4O3 |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one |
| SMILES | O=C1NC(=NO)C(F)C(NO)N1 |
| InChI | InChI=1S/C4H7FN4O3/c5-1-2(8-11)6-4(10)7-3(1)9-12/h1-2,8,11-12H,(H2,6,7,9,10) |
| InChIKey | LWWXCISNIBMHOL-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one?
The IUPAC name of 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one (CID 135428254) is 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one.
What is the SMILES notation for 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one?
The canonical SMILES for 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one is O=C1NC(=NO)C(F)C(NO)N1.
What is the InChIKey of 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one?
The InChIKey is LWWXCISNIBMHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7FN4O3/c5-1-2(8-11)6-4(10)7-3(1)9-12/h1-2,8,11-12H,(H2,6,7,9,10).
What are the key properties of 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one?
5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one has a molecular weight of 178.12 g/mol, XLogP of -1.27, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-(hydroxyamino)-6-hydroxyimino-1,3-diazinan-2-one is sourced from PubChem (CID 135428254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).