C8H10F2 — CID 91510667
1-ethyl-2,6-difluorocyclohexa-1,3-diene (PubChem CID 91510667) has the molecular formula C8H10F2 and a molecular weight of 144.16 g/mol. Its IUPAC name is 1-ethyl-2,6-difluorocyclohexa-1,3-diene.
| Compound Name | 1-ethyl-2,6-difluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91510667 |
| Molecular Formula | C8H10F2 |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 1-ethyl-2,6-difluorocyclohexa-1,3-diene |
| SMILES | CCC1=C(F)C=CCC1F |
| InChI | InChI=1S/C8H10F2/c1-2-6-7(9)4-3-5-8(6)10/h3-4,8H,2,5H2,1H3 |
| InChIKey | HVOZEKHNFMMXLW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |