C8H7BrO2 — CID 11106760
5-bromo-2,3-dimethyl(413C)cyclohexa-2,5-diene-1,4-dione (PubChem CID 11106760) has the molecular formula C8H7BrO2 and a molecular weight of 216.04 g/mol. Its IUPAC name is 5-bromo-2,3-dimethyl(413C)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-bromo-2,3-dimethyl(413C)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11106760 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 216.04 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | 5-bromo-2,3-dimethyl(413C)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)[13C](=O)C(Br)=CC1=O |
| InChI | InChI=1S/C8H7BrO2/c1-4-5(2)8(11)6(9)3-7(4)10/h3H,1-2H3/i8+1 |
| InChIKey | MRGMEMSZSWATNG-VJJZLTLGSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.04 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|