C18H22O3 — CID 158855611
2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,6-trimethylphenol (PubChem CID 158855611) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,6-trimethylphenol.
| Compound Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,6-trimethylphenol |
|---|---|
| PubChem CID | 158855611 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;2,3,6-trimethylphenol |
| SMILES | CC1=CC(=O)C(C)=C(C)C1=O.Cc1ccc(C)c(O)c1C |
| InChI | InChI=1S/C9H10O2.C9H12O/c1-5-4-8(10)6(2)7(3)9(5)11;1-6-4-5-7(2)9(10)8(6)3/h4H,1-3H3;4-5,10H,1-3H3 |
| InChIKey | IZZXFKQVRXYDGQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|