C22H24FN3O2S — CID 141414158
4-fluoro-N-[2-(4-piperazin-1-ylnaphthalen-1-yl)ethyl]benzenesulfonamide (PubChem CID 141414158) has the molecular formula C22H24FN3O2S and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-piperazin-1-ylnaphthalen-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(4-piperazin-1-ylnaphthalen-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141414158 |
| Molecular Formula | C22H24FN3O2S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-fluoro-N-[2-(4-piperazin-1-ylnaphthalen-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(N2CCNCC2)c2ccccc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O2S/c23-18-6-8-19(9-7-18)29(27,28)25-12-11-17-5-10-22(26-15-13-24-14-16-26)21-4-2-1-3-20(17)21/h1-10,24-25H,11-16H2 |
| InChIKey | QIMPWAAMMPZCBB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |