C16H22N2S — CID 141415840
3-methyl-5-[(4-phenylpiperidin-1-yl)methyl]-2H-1,3-thiazole (PubChem CID 141415840) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 3-methyl-5-[(4-phenylpiperidin-1-yl)methyl]-2H-1,3-thiazole.
| Compound Name | 3-methyl-5-[(4-phenylpiperidin-1-yl)methyl]-2H-1,3-thiazole |
|---|---|
| PubChem CID | 141415840 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-methyl-5-[(4-phenylpiperidin-1-yl)methyl]-2H-1,3-thiazole |
| SMILES | CN1C=C(CN2CCC(c3ccccc3)CC2)SC1 |
| InChI | InChI=1S/C16H22N2S/c1-17-11-16(19-13-17)12-18-9-7-15(8-10-18)14-5-3-2-4-6-14/h2-6,11,15H,7-10,12-13H2,1H3 |
| InChIKey | UAIZJOLOMQTMDQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |