C12H15F3N4O2 — CID 141418153
2-hydroxy-1-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 141418153) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 2-hydroxy-1-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 141418153 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-hydroxy-1-[3-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | O=C(CO)N1CCCC(Nc2ncc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C12H15F3N4O2/c13-12(14,15)8-4-16-11(17-5-8)18-9-2-1-3-19(6-9)10(21)7-20/h4-5,9,20H,1-3,6-7H2,(H,16,17,18) |
| InChIKey | XBSORMBFPKYNIP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |