C10H9F5N2 — CID 141423458
2-benzyl-2,4,4,5,5-pentafluoroimidazolidine (PubChem CID 141423458) has the molecular formula C10H9F5N2 and a molecular weight of 252.19 g/mol. Its IUPAC name is 2-benzyl-2,4,4,5,5-pentafluoroimidazolidine.
| Compound Name | 2-benzyl-2,4,4,5,5-pentafluoroimidazolidine |
|---|---|
| PubChem CID | 141423458 |
| Molecular Formula | C10H9F5N2 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-benzyl-2,4,4,5,5-pentafluoroimidazolidine |
| SMILES | FC1(Cc2ccccc2)NC(F)(F)C(F)(F)N1 |
| InChI | InChI=1S/C10H9F5N2/c11-8(6-7-4-2-1-3-5-7)16-9(12,13)10(14,15)17-8/h1-5,16-17H,6H2 |
| InChIKey | ATGUFCKFIIBZGE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|