C10H11F2NO2 — CID 166468732
3-benzyl-5,5-difluoro-3-methyl-1,4,2-dioxazolidine (PubChem CID 166468732) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-benzyl-5,5-difluoro-3-methyl-1,4,2-dioxazolidine.
| Compound Name | 3-benzyl-5,5-difluoro-3-methyl-1,4,2-dioxazolidine |
|---|---|
| PubChem CID | 166468732 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-benzyl-5,5-difluoro-3-methyl-1,4,2-dioxazolidine |
| SMILES | CC1(Cc2ccccc2)NOC(F)(F)O1 |
| InChI | InChI=1S/C10H11F2NO2/c1-9(13-15-10(11,12)14-9)7-8-5-3-2-4-6-8/h2-6,13H,7H2,1H3 |
| InChIKey | IBTSVGAEQRXPTO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |