C4H7N3S — CID 141423893
2-amino-2,3-dihydro-1H-pyrimidine-4-thione (PubChem CID 141423893) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1H-pyrimidine-4-thione.
| Compound Name | 2-amino-2,3-dihydro-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 141423893 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 2-amino-2,3-dihydro-1H-pyrimidine-4-thione |
| SMILES | NC1NC=CC(=S)N1 |
| InChI | InChI=1S/C4H7N3S/c5-4-6-2-1-3(8)7-4/h1-2,4,6H,5H2,(H,7,8) |
| InChIKey | XUBRADIADXINMJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|