About 5-morpholin-4-yl-3H-1,3-thiazole-2-thione
5-morpholin-4-yl-3H-1,3-thiazole-2-thione (PubChem CID 141425201) has the molecular formula C7H10N2OS2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-morpholin-4-yl-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 5-morpholin-4-yl-3H-1,3-thiazole-2-thione |
| PubChem CID | 141425201 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 5-morpholin-4-yl-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]cc(N2CCOCC2)s1 |
| InChI | InChI=1S/C7H10N2OS2/c11-7-8-5-6(12-7)9-1-3-10-4-2-9/h5H,1-4H2,(H,8,11) |
| InChIKey | RVTLVPNHRZCLIV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-morpholin-4-yl-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-morpholin-4-yl-3H-1,3-thiazole-2-thione?
The IUPAC name of 5-morpholin-4-yl-3H-1,3-thiazole-2-thione (CID 141425201) is 5-morpholin-4-yl-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 5-morpholin-4-yl-3H-1,3-thiazole-2-thione?
The canonical SMILES for 5-morpholin-4-yl-3H-1,3-thiazole-2-thione is S=c1[nH]cc(N2CCOCC2)s1.
What is the InChIKey of 5-morpholin-4-yl-3H-1,3-thiazole-2-thione?
The InChIKey is RVTLVPNHRZCLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS2/c11-7-8-5-6(12-7)9-1-3-10-4-2-9/h5H,1-4H2,(H,8,11).
What are the key properties of 5-morpholin-4-yl-3H-1,3-thiazole-2-thione?
5-morpholin-4-yl-3H-1,3-thiazole-2-thione has a molecular weight of 202.30 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-morpholin-4-yl-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 141425201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).