C7H10N2OS2 — CID 141425201
5-morpholin-4-yl-3H-1,3-thiazole-2-thione (PubChem CID 141425201) has the molecular formula C7H10N2OS2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-morpholin-4-yl-3H-1,3-thiazole-2-thione.
| Compound Name | 5-morpholin-4-yl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 141425201 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 5-morpholin-4-yl-3H-1,3-thiazole-2-thione |
| SMILES | S=c1[nH]cc(N2CCOCC2)s1 |
| InChI | InChI=1S/C7H10N2OS2/c11-7-8-5-6(12-7)9-1-3-10-4-2-9/h5H,1-4H2,(H,8,11) |
| InChIKey | RVTLVPNHRZCLIV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|