C23H38O — CID 141425986
2,2,4-trimethylicosa-6,10,14,18-tetraen-3-one (PubChem CID 141425986) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,2,4-trimethylicosa-6,10,14,18-tetraen-3-one.
| Compound Name | 2,2,4-trimethylicosa-6,10,14,18-tetraen-3-one |
|---|---|
| PubChem CID | 141425986 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 2,2,4-trimethylicosa-6,10,14,18-tetraen-3-one |
| SMILES | CC=CCCC=CCCC=CCCC=CCC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H38O/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22(24)23(3,4)5/h6-7,10-11,14-15,18-19,21H,8-9,12-13,16-17,20H2,1-5H3 |
| InChIKey | DTAVXKJROILPHT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|