C17H15N7O3 — CID 141428671
5-oxo-2-[[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]pentanoic acid (PubChem CID 141428671) has the molecular formula C17H15N7O3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 5-oxo-2-[[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]pentanoic acid.
| Compound Name | 5-oxo-2-[[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 141428671 |
| Molecular Formula | C17H15N7O3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 5-oxo-2-[[6-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)-3-pyridinyl]amino]pentanoic acid |
| SMILES | O=CCCC(Nc1ccc(-c2nnc(-c3ccccn3)nn2)nc1)C(=O)O |
| InChI | InChI=1S/C17H15N7O3/c25-9-3-5-14(17(26)27)20-11-6-7-13(19-10-11)16-23-21-15(22-24-16)12-4-1-2-8-18-12/h1-2,4,6-10,14,20H,3,5H2,(H,26,27) |
| InChIKey | YGVXHHJSLANGCM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|