C10H11Br2N3 — CID 141429790
1-(1,4-dibromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole (PubChem CID 141429790) has the molecular formula C10H11Br2N3 and a molecular weight of 333.03 g/mol. Its IUPAC name is 1-(1,4-dibromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole.
| Compound Name | 1-(1,4-dibromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 141429790 |
| Molecular Formula | C10H11Br2N3 |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 1-(1,4-dibromo-3,6-dimethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
| SMILES | CC1=CC(Br)(n2cncn2)C(C)C=C1Br |
| InChI | InChI=1S/C10H11Br2N3/c1-7-4-10(12,8(2)3-9(7)11)15-6-13-5-14-15/h3-6,8H,1-2H3 |
| InChIKey | ASLKZPNELNRDKP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|