C11H12F3N3O5S — CID 141430375
2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 141430375) has the molecular formula C11H12F3N3O5S and a molecular weight of 355.29 g/mol. Its IUPAC name is 2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
| Compound Name | 2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 141430375 |
| Molecular Formula | C11H12F3N3O5S |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C11H12F3N3O5S/c1-10(2,9(15)18)16-23(21,22)6-3-4-8(17(19)20)7(5-6)11(12,13)14/h3-5,16H,1-2H3,(H2,15,18) |
| InChIKey | JFHRJUCDQKMRQH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|