C22H27F3N4O6S — CID 90294292
3-[[2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]adamantane-1-carboxamide (PubChem CID 90294292) has the molecular formula C22H27F3N4O6S and a molecular weight of 532.54 g/mol. Its IUPAC name is 3-[[2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 3-[[2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 90294292 |
| Molecular Formula | C22H27F3N4O6S |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 3-[[2-methyl-2-[[4-nitro-3-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(NS(=O)(=O)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1)C(=O)NC12CC3CC(C1)CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C22H27F3N4O6S/c1-19(2,28-36(34,35)14-3-4-16(29(32)33)15(6-14)22(23,24)25)18(31)27-21-9-12-5-13(10-21)8-20(7-12,11-21)17(26)30/h3-4,6,12-13,28H,5,7-11H2,1-2H3,(H2,26,30)(H,27,31) |
| InChIKey | YPRFYVXYQGZZTH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|