C44H85NO8S — CID 141431293
azanium [2,3,4-trimethyl-2,4-bis[[(Z)-octadec-9-enoyl]oxy]pentan-3-yl] sulfate (PubChem CID 141431293) has the molecular formula C44H85NO8S and a molecular weight of 788.23 g/mol. Its IUPAC name is azanium [2,3,4-trimethyl-2,4-bis[[(Z)-octadec-9-enoyl]oxy]pentan-3-yl] sulfate.
| Compound Name | azanium [2,3,4-trimethyl-2,4-bis[[(Z)-octadec-9-enoyl]oxy]pentan-3-yl] sulfate |
|---|---|
| PubChem CID | 141431293 |
| Molecular Formula | C44H85NO8S |
| Molecular Weight | 788.23 g/mol |
| Exact Mass | 787.60 |
| IUPAC Name | azanium [2,3,4-trimethyl-2,4-bis[[(Z)-octadec-9-enoyl]oxy]pentan-3-yl] sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(C)(C)C(C)(OS(=O)(=O)[O-])C(C)(C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[NH4+] |
| InChI | InChI=1S/C44H82O8S.H3N/c1-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40(45)50-42(3,4)44(7,52-53(47,48)49)43(5,6)51-41(46)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-2;/h22-25H,8-21,26-39H2,1-7H3,(H,47,48,49);1H3/b24-22-,25-23-; |
| InChIKey | OGFJPGGDGLAPCL-PBAYCENZSA-N |
| XLogP | 13.32 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.23 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|