C14H23Cl3O2 — CID 173222058
(1,1,1-trichloro-2-methylpropan-2-yl) (E)-dec-4-enoate (PubChem CID 173222058) has the molecular formula C14H23Cl3O2 and a molecular weight of 329.70 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) (E)-dec-4-enoate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) (E)-dec-4-enoate |
|---|---|
| PubChem CID | 173222058 |
| Molecular Formula | C14H23Cl3O2 |
| Molecular Weight | 329.70 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) (E)-dec-4-enoate |
| SMILES | CCCCC/C=C/CCC(=O)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H23Cl3O2/c1-4-5-6-7-8-9-10-11-12(18)19-13(2,3)14(15,16)17/h8-9H,4-7,10-11H2,1-3H3/b9-8+ |
| InChIKey | NHXAZFWFUGHRAM-CMDGGOBGSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|