C20H30N2O3 — CID 141435143
methyl 3-acetamido-3-(1-amino-3-benzylpentyl)cyclobutane-1-carboxylate (PubChem CID 141435143) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 3-acetamido-3-(1-amino-3-benzylpentyl)cyclobutane-1-carboxylate.
| Compound Name | methyl 3-acetamido-3-(1-amino-3-benzylpentyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 141435143 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | methyl 3-acetamido-3-(1-amino-3-benzylpentyl)cyclobutane-1-carboxylate |
| SMILES | CCC(Cc1ccccc1)CC(N)C1(NC(C)=O)CC(C(=O)OC)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-15(10-16-8-6-5-7-9-16)11-18(21)20(22-14(2)23)12-17(13-20)19(24)25-3/h5-9,15,17-18H,4,10-13,21H2,1-3H3,(H,22,23) |
| InChIKey | YOBAZHSEUUVILE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |