C11H10F3NO3S — CID 141435454
4,4,4-trifluoro-N,N-dimethyl-3-oxo-2-(thiophene-2-carbonyl)butanamide (PubChem CID 141435454) has the molecular formula C11H10F3NO3S and a molecular weight of 293.27 g/mol. Its IUPAC name is 4,4,4-trifluoro-N,N-dimethyl-3-oxo-2-(thiophene-2-carbonyl)butanamide.
| Compound Name | 4,4,4-trifluoro-N,N-dimethyl-3-oxo-2-(thiophene-2-carbonyl)butanamide |
|---|---|
| PubChem CID | 141435454 |
| Molecular Formula | C11H10F3NO3S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4,4,4-trifluoro-N,N-dimethyl-3-oxo-2-(thiophene-2-carbonyl)butanamide |
| SMILES | CN(C)C(=O)C(C(=O)c1cccs1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO3S/c1-15(2)10(18)7(9(17)11(12,13)14)8(16)6-4-3-5-19-6/h3-5,7H,1-2H3 |
| InChIKey | GWKCBLOKBGZPPA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|