C17H23N3O5S — CID 141436862
ethyl 2-[5-(3-carbamoylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate (PubChem CID 141436862) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl 2-[5-(3-carbamoylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate.
| Compound Name | ethyl 2-[5-(3-carbamoylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 141436862 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | ethyl 2-[5-(3-carbamoylphenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate |
| SMILES | CCOC(=O)CN1CC2CN(S(=O)(=O)c3cccc(C(N)=O)c3)CC2C1 |
| InChI | InChI=1S/C17H23N3O5S/c1-2-25-16(21)11-19-7-13-9-20(10-14(13)8-19)26(23,24)15-5-3-4-12(6-15)17(18)22/h3-6,13-14H,2,7-11H2,1H3,(H2,18,22) |
| InChIKey | HSNVCTWKBBQKCG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |