C20H25FN2O — CID 141438071
(1R)-1-[2-fluoro-3-[3-(2-morpholin-2-ylethyl)phenyl]phenyl]ethanamine (PubChem CID 141438071) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-3-[3-(2-morpholin-2-ylethyl)phenyl]phenyl]ethanamine.
| Compound Name | (1R)-1-[2-fluoro-3-[3-(2-morpholin-2-ylethyl)phenyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 141438071 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1R)-1-[2-fluoro-3-[3-(2-morpholin-2-ylethyl)phenyl]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1cccc(-c2cccc(CCC3CNCCO3)c2)c1F |
| InChI | InChI=1S/C20H25FN2O/c1-14(22)18-6-3-7-19(20(18)21)16-5-2-4-15(12-16)8-9-17-13-23-10-11-24-17/h2-7,12,14,17,23H,8-11,13,22H2,1H3/t14-,17?/m1/s1 |
| InChIKey | MYVLYMNSRKAMTB-XPCCGILXSA-N |
| XLogP | 3.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |