C21H17N5O — CID 141438953
N-phenyl-4-[2-(pyridin-4-ylmethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 141438953) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-phenyl-4-[2-(pyridin-4-ylmethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-phenyl-4-[2-(pyridin-4-ylmethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 141438953 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-phenyl-4-[2-(pyridin-4-ylmethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Nc2ncnc(-c3ccccc3OCc3ccncc3)n2)cc1 |
| InChI | InChI=1S/C21H17N5O/c1-2-6-17(7-3-1)25-21-24-15-23-20(26-21)18-8-4-5-9-19(18)27-14-16-10-12-22-13-11-16/h1-13,15H,14H2,(H,23,24,25,26) |
| InChIKey | YAKFLAGPAUTQCF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |