C17H20O3 — CID 141439544
1-[2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)ethenyl]-3-methoxybenzene (PubChem CID 141439544) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-[2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)ethenyl]-3-methoxybenzene.
| Compound Name | 1-[2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)ethenyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 141439544 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-[2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)ethenyl]-3-methoxybenzene |
| SMILES | COc1cccc(C=CC2C=CC=CC2(OC)OC)c1 |
| InChI | InChI=1S/C17H20O3/c1-18-16-9-6-7-14(13-16)10-11-15-8-4-5-12-17(15,19-2)20-3/h4-13,15H,1-3H3 |
| InChIKey | PPHCIMFDEOPILE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|