C15H13ClF2N4 — CID 141442624
6-[[(1R,2S)-2-amino-1-(4-fluorophenyl)propyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile (PubChem CID 141442624) has the molecular formula C15H13ClF2N4 and a molecular weight of 322.75 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-amino-1-(4-fluorophenyl)propyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile.
| Compound Name | 6-[[(1R,2S)-2-amino-1-(4-fluorophenyl)propyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 141442624 |
| Molecular Formula | C15H13ClF2N4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-[[(1R,2S)-2-amino-1-(4-fluorophenyl)propyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile |
| SMILES | C[C@H](N)[C@H](Nc1nc(Cl)c(C#N)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13ClF2N4/c1-8(20)13(9-2-4-11(17)5-3-9)21-15-12(18)6-10(7-19)14(16)22-15/h2-6,8,13H,20H2,1H3,(H,21,22)/t8-,13-/m0/s1 |
| InChIKey | DAEZXNBMQHZYHT-SDBXPKJASA-N |
| XLogP | 3.39 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|