C17H18FN3O3 — CID 141444443
[3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl] 2-fluorobenzoate (PubChem CID 141444443) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is [3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl] 2-fluorobenzoate.
| Compound Name | [3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 141444443 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [3-amino-6-(4-hydroxycyclohexyl)pyrazin-2-yl] 2-fluorobenzoate |
| SMILES | Nc1ncc(C2CCC(O)CC2)nc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H18FN3O3/c18-13-4-2-1-3-12(13)17(23)24-16-15(19)20-9-14(21-16)10-5-7-11(22)8-6-10/h1-4,9-11,22H,5-8H2,(H2,19,20) |
| InChIKey | QPCIKSCJSSITKB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |